C15H20N+ — CID 59977920
1-methyl-2-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)ethenyl]-3H-pyrrol-1-ium (PubChem CID 59977920) has the molecular formula C15H20N+ and a molecular weight of 214.33 g/mol. Its IUPAC name is 1-methyl-2-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)ethenyl]-3H-pyrrol-1-ium.
| Compound Name | 1-methyl-2-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)ethenyl]-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 59977920 |
| Molecular Formula | C15H20N+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-methyl-2-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)ethenyl]-3H-pyrrol-1-ium |
| SMILES | CC1=C(C)C(C)=C(C=CC2=[N+](C)C=CC2)C1 |
| InChI | InChI=1S/C15H20N/c1-11-10-14(13(3)12(11)2)7-8-15-6-5-9-16(15)4/h5,7-9H,6,10H2,1-4H3/q+1 |
| InChIKey | IYZFQZZUIQIZIO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|