C14H19N2+ — CID 59977918
2,3-dimethyl-4-[2-(1-methyl-3H-pyrrol-1-ium-2-yl)ethenyl]cyclopenta-1,3-dien-1-amine (PubChem CID 59977918) has the molecular formula C14H19N2+ and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,3-dimethyl-4-[2-(1-methyl-3H-pyrrol-1-ium-2-yl)ethenyl]cyclopenta-1,3-dien-1-amine.
| Compound Name | 2,3-dimethyl-4-[2-(1-methyl-3H-pyrrol-1-ium-2-yl)ethenyl]cyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 59977918 |
| Molecular Formula | C14H19N2+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2,3-dimethyl-4-[2-(1-methyl-3H-pyrrol-1-ium-2-yl)ethenyl]cyclopenta-1,3-dien-1-amine |
| SMILES | CC1=C(N)CC(C=CC2=[N+](C)C=CC2)=C1C |
| InChI | InChI=1S/C14H18N2/c1-10-11(2)14(15)9-12(10)6-7-13-5-4-8-16(13)3/h4,6-8,15H,5,9H2,1-3H3/p+1 |
| InChIKey | AJOBUFVDBVNERM-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|