C13H20N2 — CID 90887442
2-ethenyl-N-ethyl-N-methyl-3-methyliminohepta-1,4,6-trien-1-amine (PubChem CID 90887442) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-ethenyl-N-ethyl-N-methyl-3-methyliminohepta-1,4,6-trien-1-amine.
| Compound Name | 2-ethenyl-N-ethyl-N-methyl-3-methyliminohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 90887442 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-ethenyl-N-ethyl-N-methyl-3-methyliminohepta-1,4,6-trien-1-amine |
| SMILES | C=CC=C/C(=N\C)C(C=C)=CN(C)CC |
| InChI | InChI=1S/C13H20N2/c1-6-9-10-13(14-4)12(7-2)11-15(5)8-3/h6-7,9-11H,1-2,8H2,3-5H3/b10-9?,12-11?,14-13+ |
| InChIKey | NTRPIUMWWMZQOP-OCVJNYFASA-N |
| XLogP | 2.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|