C10H13N2+ — CID 135027828
N,N-dimethyl-1-[(E)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine (PubChem CID 135027828) has the molecular formula C10H13N2+ and a molecular weight of 161.23 g/mol. Its IUPAC name is N,N-dimethyl-1-[(E)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine.
| Compound Name | N,N-dimethyl-1-[(E)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine |
|---|---|
| PubChem CID | 135027828 |
| Molecular Formula | C10H13N2+ |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N,N-dimethyl-1-[(E)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine |
| SMILES | C=c1cc[c+]c/c1=N\CN(C)C |
| InChI | InChI=1S/C10H13N2/c1-9-6-4-5-7-10(9)11-8-12(2)3/h4,6-7H,1,8H2,2-3H3/q+1/b11-10+ |
| InChIKey | DIOVWWNMLXNDMG-ZHACJKMWSA-N |
| XLogP | 0.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|