About 4-ethenyl-2,2-dimethylbenzimidazole
4-ethenyl-2,2-dimethylbenzimidazole (PubChem CID 20537676) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-ethenyl-2,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 4-ethenyl-2,2-dimethylbenzimidazole |
| PubChem CID | 20537676 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-ethenyl-2,2-dimethylbenzimidazole |
| SMILES | C=Cc1cccc2c1=NC(C)(C)N=2 |
| InChI | InChI=1S/C11H12N2/c1-4-8-6-5-7-9-10(8)13-11(2,3)12-9/h4-7H,1H2,2-3H3 |
| InChIKey | NDWREMQQKBXOCP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenyl-2,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,2-dimethylbenzimidazole?
The IUPAC name of 4-ethenyl-2,2-dimethylbenzimidazole (CID 20537676) is 4-ethenyl-2,2-dimethylbenzimidazole.
What is the SMILES notation for 4-ethenyl-2,2-dimethylbenzimidazole?
The canonical SMILES for 4-ethenyl-2,2-dimethylbenzimidazole is C=Cc1cccc2c1=NC(C)(C)N=2.
What is the InChIKey of 4-ethenyl-2,2-dimethylbenzimidazole?
The InChIKey is NDWREMQQKBXOCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-4-8-6-5-7-9-10(8)13-11(2,3)12-9/h4-7H,1H2,2-3H3.
What are the key properties of 4-ethenyl-2,2-dimethylbenzimidazole?
4-ethenyl-2,2-dimethylbenzimidazole has a molecular weight of 172.23 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,2-dimethylbenzimidazole is sourced from PubChem (CID 20537676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).