C15H24FN — CID 145143636
(Z)-N-[(E)-but-1-enyl]-3-[(E)-1-fluoroprop-1-enyl]-4-methylhept-3-en-2-imine (PubChem CID 145143636) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is (Z)-N-[(E)-but-1-enyl]-3-[(E)-1-fluoroprop-1-enyl]-4-methylhept-3-en-2-imine.
| Compound Name | (Z)-N-[(E)-but-1-enyl]-3-[(E)-1-fluoroprop-1-enyl]-4-methylhept-3-en-2-imine |
|---|---|
| PubChem CID | 145143636 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (Z)-N-[(E)-but-1-enyl]-3-[(E)-1-fluoroprop-1-enyl]-4-methylhept-3-en-2-imine |
| SMILES | C/C=C(F)\C(=C(\C)CCC)C(\C)=N\C=C\CC |
| InChI | InChI=1S/C15H24FN/c1-6-9-11-17-13(5)15(14(16)8-3)12(4)10-7-2/h8-9,11H,6-7,10H2,1-5H3/b11-9+,14-8+,15-12-,17-13+ |
| InChIKey | BDXRHSTVASFVCC-QKJLPTBMSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|