C11H14FN — CID 129215964
1-[(4E,6Z)-5-fluorocycloocta-1,4,6-trien-1-yl]-N-methylethanimine (PubChem CID 129215964) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-[(4E,6Z)-5-fluorocycloocta-1,4,6-trien-1-yl]-N-methylethanimine.
| Compound Name | 1-[(4E,6Z)-5-fluorocycloocta-1,4,6-trien-1-yl]-N-methylethanimine |
|---|---|
| PubChem CID | 129215964 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-[(4E,6Z)-5-fluorocycloocta-1,4,6-trien-1-yl]-N-methylethanimine |
| SMILES | C/N=C(\C)C1=CC/C=C(F)\C=C/C1 |
| InChI | InChI=1S/C11H14FN/c1-9(13-2)10-5-3-7-11(12)8-4-6-10/h3,6-8H,4-5H2,1-2H3/b7-3-,10-6?,11-8+,13-9+ |
| InChIKey | KNAPHCQRCRMBKC-MHBNPEOCSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|