C23H27F4N — CID 139563424
(Z)-N-[(1Z)-buta-1,3-dienyl]-3,6,7-trimethylidene-9-(4,4,5,5-tetrafluoro-2-methylcyclohexen-1-yl)non-8-en-2-imine (PubChem CID 139563424) has the molecular formula C23H27F4N and a molecular weight of 393.47 g/mol. Its IUPAC name is (Z)-N-[(1Z)-buta-1,3-dienyl]-3,6,7-trimethylidene-9-(4,4,5,5-tetrafluoro-2-methylcyclohexen-1-yl)non-8-en-2-imine.
| Compound Name | (Z)-N-[(1Z)-buta-1,3-dienyl]-3,6,7-trimethylidene-9-(4,4,5,5-tetrafluoro-2-methylcyclohexen-1-yl)non-8-en-2-imine |
|---|---|
| PubChem CID | 139563424 |
| Molecular Formula | C23H27F4N |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (Z)-N-[(1Z)-buta-1,3-dienyl]-3,6,7-trimethylidene-9-(4,4,5,5-tetrafluoro-2-methylcyclohexen-1-yl)non-8-en-2-imine |
| SMILES | C=C/C=C\N=C(/C)C(=C)CCC(=C)C(=C)/C=C\C1=C(C)CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C23H27F4N/c1-7-8-13-28-20(6)18(4)10-9-16(2)17(3)11-12-21-15-23(26,27)22(24,25)14-19(21)5/h7-8,11-13H,1-4,9-10,14-15H2,5-6H3/b12-11-,13-8-,28-20+ |
| InChIKey | CTFIUHABPDATSV-NDFYVRALSA-N |
| XLogP | 7.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|