C18H19F4NS — CID 144809567
4-[2-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)-3,4-dihydropyridin-5-yl]cyclohexa-1,3-diene-1-thiol (PubChem CID 144809567) has the molecular formula C18H19F4NS and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-[2-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)-3,4-dihydropyridin-5-yl]cyclohexa-1,3-diene-1-thiol.
| Compound Name | 4-[2-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)-3,4-dihydropyridin-5-yl]cyclohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 144809567 |
| Molecular Formula | C18H19F4NS |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[2-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)-3,4-dihydropyridin-5-yl]cyclohexa-1,3-diene-1-thiol |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)C1=NC=C(C2=CC=C(S)CC2)CC1 |
| InChI | InChI=1S/C18H19F4NS/c1-11(2)17(19,20)18(21,22)12(3)16-9-6-14(10-23-16)13-4-7-15(24)8-5-13/h4,7,10,24H,1,3,5-6,8-9H2,2H3 |
| InChIKey | FOIUDZAALCNZHX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|