C16H22F3N — CID 156184674
(3E,5E)-3-ethenyl-N-(2-methylprop-1-enyl)-6-(trifluoromethyl)nona-3,5-dien-2-imine (PubChem CID 156184674) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-N-(2-methylprop-1-enyl)-6-(trifluoromethyl)nona-3,5-dien-2-imine.
| Compound Name | (3E,5E)-3-ethenyl-N-(2-methylprop-1-enyl)-6-(trifluoromethyl)nona-3,5-dien-2-imine |
|---|---|
| PubChem CID | 156184674 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (3E,5E)-3-ethenyl-N-(2-methylprop-1-enyl)-6-(trifluoromethyl)nona-3,5-dien-2-imine |
| SMILES | CCC/C(=C\C=C(/C=C)\C(=NC=C(C)C)C)/C(F)(F)F |
| InChI | InChI=1S/C16H22F3N/c1-6-8-15(16(17,18)19)10-9-14(7-2)13(5)20-11-12(3)4/h7,9-11H,2,6,8H2,1,3-5H3/b14-9+,15-10+,20-13? |
| InChIKey | RHYJTWUYHRWCSG-JTZBXITCSA-N |
| XLogP | 5.90 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 445 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|