C16H26F3N — CID 130182822
7,7,7-trifluoro-N-[(3Z,5Z)-5-methylocta-3,5-dienyl]heptan-2-imine (PubChem CID 130182822) has the molecular formula C16H26F3N and a molecular weight of 289.39 g/mol. Its IUPAC name is 7,7,7-trifluoro-N-[(3Z,5Z)-5-methylocta-3,5-dienyl]heptan-2-imine.
| Compound Name | 7,7,7-trifluoro-N-[(3Z,5Z)-5-methylocta-3,5-dienyl]heptan-2-imine |
|---|---|
| PubChem CID | 130182822 |
| Molecular Formula | C16H26F3N |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 7,7,7-trifluoro-N-[(3Z,5Z)-5-methylocta-3,5-dienyl]heptan-2-imine |
| SMILES | CC/C=C(C)\C=C/CC/N=C(\C)CCCCC(F)(F)F |
| InChI | InChI=1S/C16H26F3N/c1-4-9-14(2)10-6-8-13-20-15(3)11-5-7-12-16(17,18)19/h6,9-10H,4-5,7-8,11-13H2,1-3H3/b10-6-,14-9-,20-15+ |
| InChIKey | YIARSQYIDUZIIV-RGOVFEBCSA-N |
| XLogP | 5.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|