C12H18F3N — CID 166122432
(E)-8,8,8-trifluoro-N,3,4-trimethyl-5-methylideneoct-3-en-2-imine (PubChem CID 166122432) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (E)-8,8,8-trifluoro-N,3,4-trimethyl-5-methylideneoct-3-en-2-imine.
| Compound Name | (E)-8,8,8-trifluoro-N,3,4-trimethyl-5-methylideneoct-3-en-2-imine |
|---|---|
| PubChem CID | 166122432 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (E)-8,8,8-trifluoro-N,3,4-trimethyl-5-methylideneoct-3-en-2-imine |
| SMILES | C=C(CCC(F)(F)F)/C(C)=C(C)/C(C)=N/C |
| InChI | InChI=1S/C12H18F3N/c1-8(6-7-12(13,14)15)9(2)10(3)11(4)16-5/h1,6-7H2,2-5H3/b10-9+,16-11+ |
| InChIKey | CUWBRXAHFYXARG-AKYRVGECSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|