C12H18FN — CID 176952835
3-fluoro-N-[(1E,3E,5E)-2-methylhepta-1,3,5-trienyl]butan-2-imine (PubChem CID 176952835) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 3-fluoro-N-[(1E,3E,5E)-2-methylhepta-1,3,5-trienyl]butan-2-imine.
| Compound Name | 3-fluoro-N-[(1E,3E,5E)-2-methylhepta-1,3,5-trienyl]butan-2-imine |
|---|---|
| PubChem CID | 176952835 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-fluoro-N-[(1E,3E,5E)-2-methylhepta-1,3,5-trienyl]butan-2-imine |
| SMILES | C/C=C/C=C/C(C)=C/N=C(\C)C(C)F |
| InChI | InChI=1S/C12H18FN/c1-5-6-7-8-10(2)9-14-12(4)11(3)13/h5-9,11H,1-4H3/b6-5+,8-7+,10-9+,14-12+ |
| InChIKey | JIUFBGUZLLDXJK-WHTZFLHMSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|