C8H9N2+ — CID 123414029
7-methyl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-amine (PubChem CID 123414029) has the molecular formula C8H9N2+ and a molecular weight of 133.17 g/mol. Its IUPAC name is 7-methyl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-amine.
| Compound Name | 7-methyl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-amine |
|---|---|
| PubChem CID | 123414029 |
| Molecular Formula | C8H9N2+ |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.08 |
| IUPAC Name | 7-methyl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-4-amine |
| SMILES | C[N+]1=c2cc(N)ccc2=C1 |
| InChI | InChI=1S/C8H8N2/c1-10-5-6-2-3-7(9)4-8(6)10/h2-5,9H,1H3/p+1 |
| InChIKey | DLCFINUELVOFAB-UHFFFAOYSA-O |
| XLogP | -0.86 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|