C14H12N2 — CID 69292210
1,2-dihydropyrido[2,3-c][1]benzazocine (PubChem CID 69292210) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,2-dihydropyrido[2,3-c][1]benzazocine.
| Compound Name | 1,2-dihydropyrido[2,3-c][1]benzazocine |
|---|---|
| PubChem CID | 69292210 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1,2-dihydropyrido[2,3-c][1]benzazocine |
| SMILES | C1=CC2=CC=c3cccc/c3=N/C=C2NC1 |
| InChI | InChI=1S/C14H12N2/c1-2-6-13-11(4-1)7-8-12-5-3-9-15-14(12)10-16-13/h1-8,10,15H,9H2/b8-7?,11-7?,12-8?,14-10?,16-10?,16-13- |
| InChIKey | OYVXIUSNIYFERG-COVOMLPGSA-N |
| XLogP | 1.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |