C13H12N2 — CID 91293056
1,6-dihydrobenzo[a]quinolizin-2-imine (PubChem CID 91293056) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1,6-dihydrobenzo[a]quinolizin-2-imine.
| Compound Name | 1,6-dihydrobenzo[a]quinolizin-2-imine |
|---|---|
| PubChem CID | 91293056 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1,6-dihydrobenzo[a]quinolizin-2-imine |
| SMILES | [H]/N=C1\C=CN2CC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H12N2/c14-11-6-8-15-7-5-10-3-1-2-4-12(10)13(15)9-11/h1-6,8,14H,7,9H2/b14-11+ |
| InChIKey | UJFMIIZYKDUBIK-SDNWHVSQSA-N |
| XLogP | 0.83 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|