About 6-ethenyl-4H-pyrazino[2,3-c]carbazole
6-ethenyl-4H-pyrazino[2,3-c]carbazole (PubChem CID 177255998) has the molecular formula C16H11N3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-ethenyl-4H-pyrazino[2,3-c]carbazole.
Molecular Properties
| Compound Name | 6-ethenyl-4H-pyrazino[2,3-c]carbazole |
| PubChem CID | 177255998 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-ethenyl-4H-pyrazino[2,3-c]carbazole |
| SMILES | C=Cc1cc2[nH]ccnc2c2c1nc1ccccc12 |
| InChI | InChI=1S/C16H11N3/c1-2-10-9-13-16(18-8-7-17-13)14-11-5-3-4-6-12(11)19-15(10)14/h2-9,17H,1H2 |
| InChIKey | OCIYWABEBGTCBR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenyl-4H-pyrazino[2,3-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-4H-pyrazino[2,3-c]carbazole?
The IUPAC name of 6-ethenyl-4H-pyrazino[2,3-c]carbazole (CID 177255998) is 6-ethenyl-4H-pyrazino[2,3-c]carbazole.
What is the SMILES notation for 6-ethenyl-4H-pyrazino[2,3-c]carbazole?
The canonical SMILES for 6-ethenyl-4H-pyrazino[2,3-c]carbazole is C=Cc1cc2[nH]ccnc2c2c1nc1ccccc12.
What is the InChIKey of 6-ethenyl-4H-pyrazino[2,3-c]carbazole?
The InChIKey is OCIYWABEBGTCBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3/c1-2-10-9-13-16(18-8-7-17-13)14-11-5-3-4-6-12(11)19-15(10)14/h2-9,17H,1H2.
What are the key properties of 6-ethenyl-4H-pyrazino[2,3-c]carbazole?
6-ethenyl-4H-pyrazino[2,3-c]carbazole has a molecular weight of 245.28 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-4H-pyrazino[2,3-c]carbazole is sourced from PubChem (CID 177255998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).