C13H8N4 — CID 135894299
8H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 135894299) has the molecular formula C13H8N4 and a molecular weight of 220.24 g/mol. Its IUPAC name is 8H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 8H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 135894299 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 8H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1ncnc1c1ccc[nH]c12 |
| InChI | InChI=1S/C13H8N4/c1-3-8-10(14-5-1)11-9(4-2-6-15-11)13-12(8)16-7-17-13/h1-7,14H |
| InChIKey | QMXBFHATIGMMHA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|