C14H15N3 — CID 135530303
3H-Pyrrolo[3,2-f]quinoline-1-methanamine, N,N-dimethyl- (PubChem CID 135530303) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N,N-dimethyl-1-(6H-pyrrolo[3,2-f]quinolin-1-yl)methanamine.
| Compound Name | 3H-Pyrrolo[3,2-f]quinoline-1-methanamine, N,N-dimethyl- |
|---|---|
| PubChem CID | 135530303 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N,N-dimethyl-1-(6H-pyrrolo[3,2-f]quinolin-1-yl)methanamine |
| SMILES | CN(C)CC1=C2C3=CC=CNC3=CC=C2N=C1 |
| InChI | InChI=1S/C14H15N3/c1-17(2)9-10-8-16-13-6-5-12-11(14(10)13)4-3-7-15-12/h3-8,15H,9H2,1-2H3 |
| InChIKey | KYNYVJZMXSBWBS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 27.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 540 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |