C11H10N2 — CID 139024388
5,9-dihydro-4H-pyrido[3,4-b]indole (PubChem CID 139024388) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 5,9-dihydro-4H-pyrido[3,4-b]indole.
| Compound Name | 5,9-dihydro-4H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 139024388 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5,9-dihydro-4H-pyrido[3,4-b]indole |
| SMILES | C1=CCc2c3c([nH]c2=C1)=CN=CC3 |
| InChI | InChI=1S/C11H10N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-2,4,6-7,13H,3,5H2 |
| InChIKey | XZJYXOJFUPTOCG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |