C12H10N2 — CID 136629763
1-methylidene-5,9-dihydropyrido[4,3-b]indole (PubChem CID 136629763) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-methylidene-5,9-dihydropyrido[4,3-b]indole.
| Compound Name | 1-methylidene-5,9-dihydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 136629763 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 1-methylidene-5,9-dihydropyrido[4,3-b]indole |
| SMILES | C=c1nccc2[nH]c3c(c12)CC=CC=3 |
| InChI | InChI=1S/C12H10N2/c1-8-12-9-4-2-3-5-10(9)14-11(12)6-7-13-8/h2-3,5-7,14H,1,4H2 |
| InChIKey | JYARJMZQHIFPIT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |