C11H10N2 — CID 66919674
2,3-dihydro-1H-pyrrolo[2,3-h]isoquinoline (PubChem CID 66919674) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[2,3-h]isoquinoline.
| Compound Name | 2,3-dihydro-1H-pyrrolo[2,3-h]isoquinoline |
|---|---|
| PubChem CID | 66919674 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[2,3-h]isoquinoline |
| SMILES | C1=Cc2c3c(ccc2=N1)=CCNC3 |
| InChI | InChI=1S/C11H10N2/c1-2-11-9(4-6-13-11)10-7-12-5-3-8(1)10/h1-4,6,12H,5,7H2 |
| InChIKey | OKFRBBZZKZXUSB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |