C17H20N2 — CID 137346134
N,N-diethyl-2,3-dihydroacridin-2-amine (PubChem CID 137346134) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N,N-diethyl-2,3-dihydroacridin-2-amine.
| Compound Name | N,N-diethyl-2,3-dihydroacridin-2-amine |
|---|---|
| PubChem CID | 137346134 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N,N-diethyl-2,3-dihydroacridin-2-amine |
| SMILES | CCN(CC)C1C=c2cc3ccccc3nc2=CC1 |
| InChI | InChI=1S/C17H20N2/c1-3-19(4-2)15-9-10-17-14(12-15)11-13-7-5-6-8-16(13)18-17/h5-8,10-12,15H,3-4,9H2,1-2H3 |
| InChIKey | AQCLBLKJJFDWMK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |