C14H17N2+ — CID 135039127
(7E)-1,2,3,4,5,6-hexahydroazonino[5,4-b]indol-8-ium (PubChem CID 135039127) has the molecular formula C14H17N2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is (7E)-1,2,3,4,5,6-hexahydroazonino[5,4-b]indol-8-ium.
| Compound Name | (7E)-1,2,3,4,5,6-hexahydroazonino[5,4-b]indol-8-ium |
|---|---|
| PubChem CID | 135039127 |
| Molecular Formula | C14H17N2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (7E)-1,2,3,4,5,6-hexahydroazonino[5,4-b]indol-8-ium |
| SMILES | C1=C2/[NH+]=c3ccccc3=C2CCNCCC/1 |
| InChI | InChI=1S/C14H16N2/c1-2-6-13-11(5-1)12-8-10-15-9-4-3-7-14(12)16-13/h1-2,5-7,15H,3-4,8-10H2/p+1/b14-7+ |
| InChIKey | ASZFEBGWNYZLIW-VGOFMYFVSA-O |
| XLogP | -0.79 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |