About 7H-indol-5-amine
7H-indol-5-amine (PubChem CID 67505292) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 7H-indol-5-amine.
Molecular Properties
| Compound Name | 7H-indol-5-amine |
| PubChem CID | 67505292 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 7H-indol-5-amine |
| SMILES | NC1=CCC2=NC=CC2=C1 |
| InChI | InChI=1S/C8H8N2/c9-7-1-2-8-6(5-7)3-4-10-8/h1,3-5H,2,9H2 |
| InChIKey | IVFSSRFCHBRCJG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-indol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-indol-5-amine?
The IUPAC name of 7H-indol-5-amine (CID 67505292) is 7H-indol-5-amine.
What is the SMILES notation for 7H-indol-5-amine?
The canonical SMILES for 7H-indol-5-amine is NC1=CCC2=NC=CC2=C1.
What is the InChIKey of 7H-indol-5-amine?
The InChIKey is IVFSSRFCHBRCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c9-7-1-2-8-6(5-7)3-4-10-8/h1,3-5H,2,9H2.
What are the key properties of 7H-indol-5-amine?
7H-indol-5-amine has a molecular weight of 132.17 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-indol-5-amine is sourced from PubChem (CID 67505292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).