C12H17N2+ — CID 59893250
N-methyl-6-(1-methyl-3H-pyrrol-1-ium-2-yl)hexa-1,3,5-trien-1-amine (PubChem CID 59893250) has the molecular formula C12H17N2+ and a molecular weight of 189.28 g/mol. Its IUPAC name is N-methyl-6-(1-methyl-3H-pyrrol-1-ium-2-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | N-methyl-6-(1-methyl-3H-pyrrol-1-ium-2-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 59893250 |
| Molecular Formula | C12H17N2+ |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-methyl-6-(1-methyl-3H-pyrrol-1-ium-2-yl)hexa-1,3,5-trien-1-amine |
| SMILES | CNC=CC=CC=CC1=[N+](C)C=CC1 |
| InChI | InChI=1S/C12H16N2/c1-13-10-6-4-3-5-8-12-9-7-11-14(12)2/h3-8,10-11H,9H2,1-2H3/p+1 |
| InChIKey | DJZNKTFWXOAHJD-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|