C15H23FN2 — CID 177041004
(2E,4E)-6-[(Z)-but-2-en-2-yl]imino-N-ethenyl-4-fluoronona-2,4-dien-3-amine (PubChem CID 177041004) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is (2E,4E)-6-[(Z)-but-2-en-2-yl]imino-N-ethenyl-4-fluoronona-2,4-dien-3-amine.
| Compound Name | (2E,4E)-6-[(Z)-but-2-en-2-yl]imino-N-ethenyl-4-fluoronona-2,4-dien-3-amine |
|---|---|
| PubChem CID | 177041004 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (2E,4E)-6-[(Z)-but-2-en-2-yl]imino-N-ethenyl-4-fluoronona-2,4-dien-3-amine |
| SMILES | C=CNC(=C/C)/C(F)=C\C(CCC)=N/C(C)=C\C |
| InChI | InChI=1S/C15H23FN2/c1-6-10-13(18-12(5)7-2)11-14(16)15(8-3)17-9-4/h7-9,11,17H,4,6,10H2,1-3,5H3/b12-7-,14-11+,15-8+,18-13- |
| InChIKey | JBWRVASDHNMSGV-SWWSGFENSA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|