C31H34N2O2 — CID 142917086
(E)-4-[[(2Z,5Z)-4-[1-[4-(3-oxo-3-phenylprop-1-en-2-yl)phenyl]ethenylimino]hepta-2,5-dien-3-yl]amino]hept-3-en-2-one (PubChem CID 142917086) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is (E)-4-[[(2Z,5Z)-4-[1-[4-(3-oxo-3-phenylprop-1-en-2-yl)phenyl]ethenylimino]hepta-2,5-dien-3-yl]amino]hept-3-en-2-one.
| Compound Name | (E)-4-[[(2Z,5Z)-4-[1-[4-(3-oxo-3-phenylprop-1-en-2-yl)phenyl]ethenylimino]hepta-2,5-dien-3-yl]amino]hept-3-en-2-one |
|---|---|
| PubChem CID | 142917086 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (E)-4-[[(2Z,5Z)-4-[1-[4-(3-oxo-3-phenylprop-1-en-2-yl)phenyl]ethenylimino]hepta-2,5-dien-3-yl]amino]hept-3-en-2-one |
| SMILES | C=C(/N=C(\C=C/C)C(=C/C)/N/C(=C/C(C)=O)CCC)c1ccc(C(=C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2O2/c1-7-13-28(21-22(4)34)33-29(9-3)30(14-8-2)32-24(6)26-19-17-25(18-20-26)23(5)31(35)27-15-11-10-12-16-27/h8-12,14-21,33H,5-7,13H2,1-4H3/b14-8-,28-21+,29-9-,32-30+ |
| InChIKey | QYPVGPIMBLVWNW-YWZIKLPESA-N |
| XLogP | 7.34 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|