C32H40N2O — CID 142897756
ethane;(4Z,8Z)-6-methylidene-7-[1-(4-methylphenyl)ethenylimino]-4-[1-[(4-methylphenyl)methylamino]ethenyl]deca-4,8-dien-3-one (PubChem CID 142897756) has the molecular formula C32H40N2O and a molecular weight of 468.69 g/mol. Its IUPAC name is ethane;(4Z,8Z)-6-methylidene-7-[1-(4-methylphenyl)ethenylimino]-4-[1-[(4-methylphenyl)methylamino]ethenyl]deca-4,8-dien-3-one.
| Compound Name | ethane;(4Z,8Z)-6-methylidene-7-[1-(4-methylphenyl)ethenylimino]-4-[1-[(4-methylphenyl)methylamino]ethenyl]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 142897756 |
| Molecular Formula | C32H40N2O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | ethane;(4Z,8Z)-6-methylidene-7-[1-(4-methylphenyl)ethenylimino]-4-[1-[(4-methylphenyl)methylamino]ethenyl]deca-4,8-dien-3-one |
| SMILES | C=C(NCc1ccc(C)cc1)/C(=C\C(=C)C(/C=C\C)=N/C(=C)c1ccc(C)cc1)C(=O)CC.CC |
| InChI | InChI=1S/C30H34N2O.C2H6/c1-8-10-29(32-24(6)27-17-13-22(4)14-18-27)23(5)19-28(30(33)9-2)25(7)31-20-26-15-11-21(3)12-16-26;1-2/h8,10-19,31H,5-7,9,20H2,1-4H3;1-2H3/b10-8-,28-19-,32-29+; |
| InChIKey | KBMKXLGBLFGJQD-RVJWULPSSA-N |
| XLogP | 8.08 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|