C24H30BrNO — CID 142916755
(E)-4-[[(2Z,4E)-6-[3-(bromomethyl)phenyl]-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]amino]hept-3-en-2-one (PubChem CID 142916755) has the molecular formula C24H30BrNO and a molecular weight of 428.41 g/mol. Its IUPAC name is (E)-4-[[(2Z,4E)-6-[3-(bromomethyl)phenyl]-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]amino]hept-3-en-2-one.
| Compound Name | (E)-4-[[(2Z,4E)-6-[3-(bromomethyl)phenyl]-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]amino]hept-3-en-2-one |
|---|---|
| PubChem CID | 142916755 |
| Molecular Formula | C24H30BrNO |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (E)-4-[[(2Z,4E)-6-[3-(bromomethyl)phenyl]-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]amino]hept-3-en-2-one |
| SMILES | C=C(/C=C(\C=C/C)C(=C/C)/N/C(=C/C(C)=O)CCC)c1cccc(CBr)c1 |
| InChI | InChI=1S/C24H30BrNO/c1-6-10-22(14-18(4)21-13-9-12-20(16-21)17-25)24(8-3)26-23(11-7-2)15-19(5)27/h6,8-10,12-16,26H,4,7,11,17H2,1-3,5H3/b10-6-,22-14+,23-15+,24-8- |
| InChIKey | LLWJFQBNMREICM-SIYZHBNCSA-N |
| XLogP | 6.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|