C17H24BrClO — CID 168985264
(3E,5Z)-4-bromohepta-3,5-dien-2-one;1-chloro-3-ethylbenzene;ethane (PubChem CID 168985264) has the molecular formula C17H24BrClO and a molecular weight of 359.74 g/mol. Its IUPAC name is (3E,5Z)-4-bromohepta-3,5-dien-2-one;1-chloro-3-ethylbenzene;ethane.
| Compound Name | (3E,5Z)-4-bromohepta-3,5-dien-2-one;1-chloro-3-ethylbenzene;ethane |
|---|---|
| PubChem CID | 168985264 |
| Molecular Formula | C17H24BrClO |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (3E,5Z)-4-bromohepta-3,5-dien-2-one;1-chloro-3-ethylbenzene;ethane |
| SMILES | C/C=C\C(Br)=C/C(C)=O.CC.CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H9Cl.C7H9BrO.C2H6/c1-2-7-4-3-5-8(9)6-7;1-3-4-7(8)5-6(2)9;1-2/h3-6H,2H2,1H3;3-5H,1-2H3;1-2H3/b;4-3-,7-5+; |
| InChIKey | XPZROTCOYGEARH-CGEANTRFSA-N |
| XLogP | 6.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|