C12H11ClO2 — CID 11379072
(Z)-1-(3-chlorophenyl)hex-3-ene-2,5-dione (PubChem CID 11379072) has the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. Its IUPAC name is (Z)-1-(3-chlorophenyl)hex-3-ene-2,5-dione.
| Compound Name | (Z)-1-(3-chlorophenyl)hex-3-ene-2,5-dione |
|---|---|
| PubChem CID | 11379072 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (Z)-1-(3-chlorophenyl)hex-3-ene-2,5-dione |
| SMILES | CC(=O)/C=C\C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClO2/c1-9(14)5-6-12(15)8-10-3-2-4-11(13)7-10/h2-7H,8H2,1H3/b6-5- |
| InChIKey | WEGGNDBKLGRWBS-WAYWQWQTSA-N |
| XLogP | 2.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|