C14H17Cl — CID 144850681
1-chloro-3-[(2E,4Z)-2-methylhepta-2,4-dienyl]benzene (PubChem CID 144850681) has the molecular formula C14H17Cl and a molecular weight of 220.74 g/mol. Its IUPAC name is 1-chloro-3-[(2E,4Z)-2-methylhepta-2,4-dienyl]benzene.
| Compound Name | 1-chloro-3-[(2E,4Z)-2-methylhepta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 144850681 |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-chloro-3-[(2E,4Z)-2-methylhepta-2,4-dienyl]benzene |
| SMILES | CC/C=C\C=C(/C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl/c1-3-4-5-7-12(2)10-13-8-6-9-14(15)11-13/h4-9,11H,3,10H2,1-2H3/b5-4-,12-7+ |
| InChIKey | BLKYOPGBDTXJGB-HCRNJAACSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|