C17H17ClS — CID 161325475
1-(3-chlorophenyl)-3-(2,6-dimethylphenyl)propane-2-thione (PubChem CID 161325475) has the molecular formula C17H17ClS and a molecular weight of 288.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,6-dimethylphenyl)propane-2-thione.
| Compound Name | 1-(3-chlorophenyl)-3-(2,6-dimethylphenyl)propane-2-thione |
|---|---|
| PubChem CID | 161325475 |
| Molecular Formula | C17H17ClS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,6-dimethylphenyl)propane-2-thione |
| SMILES | Cc1cccc(C)c1CC(=S)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClS/c1-12-5-3-6-13(2)17(12)11-16(19)10-14-7-4-8-15(18)9-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | VKSBEEJXQXGWDL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|