C17H14ClNa2O6P — CID 58387374
disodium;[5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] phosphate (PubChem CID 58387374) has the molecular formula C17H14ClNa2O6P and a molecular weight of 426.70 g/mol. Its IUPAC name is disodium;[5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] phosphate.
| Compound Name | disodium;[5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] phosphate |
|---|---|
| PubChem CID | 58387374 |
| Molecular Formula | C17H14ClNa2O6P |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | disodium;[5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] phosphate |
| SMILES | COc1ccc(/C=C/C(=O)Cc2cccc(Cl)c2)cc1OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H16ClO6P.2Na/c1-23-16-8-6-12(11-17(16)24-25(20,21)22)5-7-15(19)10-13-3-2-4-14(18)9-13;;/h2-9,11H,10H2,1H3,(H2,20,21,22);;/q;2*+1/p-2/b7-5+;; |
| InChIKey | HJVYAXUVEOOMSK-WVKUUHRJSA-L |
| XLogP | -3.61 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|