C17H16ClO6P — CID 58387375
[5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] dihydrogen phosphate (PubChem CID 58387375) has the molecular formula C17H16ClO6P and a molecular weight of 382.74 g/mol. Its IUPAC name is [5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] dihydrogen phosphate.
| Compound Name | [5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58387375 |
| Molecular Formula | C17H16ClO6P |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [5-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-2-methoxyphenyl] dihydrogen phosphate |
| SMILES | COc1ccc(/C=C/C(=O)Cc2cccc(Cl)c2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C17H16ClO6P/c1-23-16-8-6-12(11-17(16)24-25(20,21)22)5-7-15(19)10-13-3-2-4-14(18)9-13/h2-9,11H,10H2,1H3,(H2,20,21,22)/b7-5+ |
| InChIKey | MYGFWCKVLOYHBP-FNORWQNLSA-N |
| XLogP | 3.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|