C11H16N2 — CID 90943080
(4E,7Z)-5-methyl-8-N,6-dimethylideneocta-4,7-diene-3,8-diimine (PubChem CID 90943080) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (4E,7Z)-5-methyl-8-N,6-dimethylideneocta-4,7-diene-3,8-diimine.
| Compound Name | (4E,7Z)-5-methyl-8-N,6-dimethylideneocta-4,7-diene-3,8-diimine |
|---|---|
| PubChem CID | 90943080 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (4E,7Z)-5-methyl-8-N,6-dimethylideneocta-4,7-diene-3,8-diimine |
| SMILES | [H]/N=C(/C=C(\C)C(=C)/C=C\N=C)CC |
| InChI | InChI=1S/C11H16N2/c1-5-11(12)8-10(3)9(2)6-7-13-4/h6-8,12H,2,4-5H2,1,3H3/b7-6-,10-8+,12-11+ |
| InChIKey | LVXXWDGJRZOPIU-YKMBNXPCSA-N |
| XLogP | 3.13 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|