C19H30N2 — CID 91493860
N-(4-ethyl-2,7-dimethyl-2H-azepin-5-yl)-5-methyloct-6-en-2-imine (PubChem CID 91493860) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is N-(4-ethyl-2,7-dimethyl-2H-azepin-5-yl)-5-methyloct-6-en-2-imine.
| Compound Name | N-(4-ethyl-2,7-dimethyl-2H-azepin-5-yl)-5-methyloct-6-en-2-imine |
|---|---|
| PubChem CID | 91493860 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-(4-ethyl-2,7-dimethyl-2H-azepin-5-yl)-5-methyloct-6-en-2-imine |
| SMILES | CC=CC(C)CC/C(C)=N/C1=CC(C)=NC(C)C=C1CC |
| InChI | InChI=1S/C19H30N2/c1-7-9-14(3)10-11-15(4)21-19-13-17(6)20-16(5)12-18(19)8-2/h7,9,12-14,16H,8,10-11H2,1-6H3/b9-7?,21-15+ |
| InChIKey | QFOMQRKGYDDTJX-ZXQCHIKLSA-N |
| XLogP | 5.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|