C34H44N2 — CID 123655961
2-[(1Z)-3-cyclopropylpenta-1,3-dienyl]-N-[(1E)-3,5-dimethylhepta-1,3-dienyl]-3,6-dimethyl-7-[(3E,5Z)-7-methylocta-1,3,5,7-tetraen-3-yl]azepin-4-imine (PubChem CID 123655961) has the molecular formula C34H44N2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 2-[(1Z)-3-cyclopropylpenta-1,3-dienyl]-N-[(1E)-3,5-dimethylhepta-1,3-dienyl]-3,6-dimethyl-7-[(3E,5Z)-7-methylocta-1,3,5,7-tetraen-3-yl]azepin-4-imine.
| Compound Name | 2-[(1Z)-3-cyclopropylpenta-1,3-dienyl]-N-[(1E)-3,5-dimethylhepta-1,3-dienyl]-3,6-dimethyl-7-[(3E,5Z)-7-methylocta-1,3,5,7-tetraen-3-yl]azepin-4-imine |
|---|---|
| PubChem CID | 123655961 |
| Molecular Formula | C34H44N2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 2-[(1Z)-3-cyclopropylpenta-1,3-dienyl]-N-[(1E)-3,5-dimethylhepta-1,3-dienyl]-3,6-dimethyl-7-[(3E,5Z)-7-methylocta-1,3,5,7-tetraen-3-yl]azepin-4-imine |
| SMILES | C=C/C(=C\C=C/C(=C)C)c1nc(/C=C\C(=CC)C2CC2)c(C)/c(=N/C=C/C(C)=CC(C)CC)cc1C |
| InChI | InChI=1S/C34H44N2/c1-10-25(6)22-26(7)20-21-35-33-23-27(8)34(30(12-3)15-13-14-24(4)5)36-32(28(33)9)19-18-29(11-2)31-16-17-31/h11-15,18-23,25,31H,3-4,10,16-17H2,1-2,5-9H3/b14-13-,19-18-,21-20+,26-22?,29-11?,30-15+,35-33+ |
| InChIKey | RQHLOHVNDBTDAA-BYKWTBAVSA-N |
| XLogP | 9.18 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|