C25H40N2 — CID 172585510
(E)-N-[(Z)-but-1-enyl]-1-cyclopropyl-3-methyl-2-[(Z)-1-[[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]hex-2-en-1-imine (PubChem CID 172585510) has the molecular formula C25H40N2 and a molecular weight of 368.61 g/mol. Its IUPAC name is (E)-N-[(Z)-but-1-enyl]-1-cyclopropyl-3-methyl-2-[(Z)-1-[[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]hex-2-en-1-imine.
| Compound Name | (E)-N-[(Z)-but-1-enyl]-1-cyclopropyl-3-methyl-2-[(Z)-1-[[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]hex-2-en-1-imine |
|---|---|
| PubChem CID | 172585510 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | (E)-N-[(Z)-but-1-enyl]-1-cyclopropyl-3-methyl-2-[(Z)-1-[[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]hex-2-en-1-imine |
| SMILES | CC/C=C\N=C(\C(=C(C)CCC)C(=C/CC)/N=C/C=C(\C)CCC)C1CC1 |
| InChI | InChI=1S/C25H40N2/c1-7-11-18-27-25(22-15-16-22)24(21(6)13-9-3)23(14-10-4)26-19-17-20(5)12-8-2/h11,14,17-19,22H,7-10,12-13,15-16H2,1-6H3/b18-11-,20-17+,23-14-,24-21+,26-19+,27-25+ |
| InChIKey | WBMSCYLIIQJFGW-DHJGTTKLSA-N |
| XLogP | 7.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|