C23H40N2 — CID 153355166
(3Z,6Z,8Z)-5-N,4-bis(ethenyl)-6-N-ethylidene-7-methyldeca-1,3,6,8-tetraene-5,6-diimine;ethane (PubChem CID 153355166) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is (3Z,6Z,8Z)-5-N,4-bis(ethenyl)-6-N-ethylidene-7-methyldeca-1,3,6,8-tetraene-5,6-diimine;ethane.
| Compound Name | (3Z,6Z,8Z)-5-N,4-bis(ethenyl)-6-N-ethylidene-7-methyldeca-1,3,6,8-tetraene-5,6-diimine;ethane |
|---|---|
| PubChem CID | 153355166 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | (3Z,6Z,8Z)-5-N,4-bis(ethenyl)-6-N-ethylidene-7-methyldeca-1,3,6,8-tetraene-5,6-diimine;ethane |
| SMILES | C=C/C=C(C=C)\C(=N/C=C)C(/N=C/C)=C(C)\C=C/C.CC.CC.CC |
| InChI | InChI=1S/C17H22N2.3C2H6/c1-7-12-14(6)16(18-10-4)17(19-11-5)15(9-3)13-8-2;3*1-2/h7-13H,2-3,5H2,1,4,6H3;3*1-2H3/b12-7-,15-13-,16-14-,18-10+,19-17+;;; |
| InChIKey | ZUOYGOQIYWIGBG-QRHYIRLHSA-N |
| XLogP | 7.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|