C12H16N2 — CID 90904084
N,3-bis(ethenyl)-N'-methyl-2-methylidenehex-3-ene-1,6-diimine (PubChem CID 90904084) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N,3-bis(ethenyl)-N'-methyl-2-methylidenehex-3-ene-1,6-diimine.
| Compound Name | N,3-bis(ethenyl)-N'-methyl-2-methylidenehex-3-ene-1,6-diimine |
|---|---|
| PubChem CID | 90904084 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N,3-bis(ethenyl)-N'-methyl-2-methylidenehex-3-ene-1,6-diimine |
| SMILES | C=C/N=C/C(=C)C(C=C)=CC/C=N/C |
| InChI | InChI=1S/C12H16N2/c1-5-12(8-7-9-13-4)11(3)10-14-6-2/h5-6,8-10H,1-3,7H2,4H3/b12-8?,13-9+,14-10+ |
| InChIKey | HGZYAHWPBWBNQE-BJHACKFKSA-N |
| XLogP | 2.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|