C27H43N3 — CID 142967495
N,2-dimethyl-N'-(5-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl)pentane-1,5-diimine;(3Z)-hexa-1,3,5-triene;N,2,2-trimethylpropan-1-imine (PubChem CID 142967495) has the molecular formula C27H43N3 and a molecular weight of 409.66 g/mol. Its IUPAC name is N,2-dimethyl-N'-(5-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl)pentane-1,5-diimine;(3Z)-hexa-1,3,5-triene;N,2,2-trimethylpropan-1-imine.
| Compound Name | N,2-dimethyl-N'-(5-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl)pentane-1,5-diimine;(3Z)-hexa-1,3,5-triene;N,2,2-trimethylpropan-1-imine |
|---|---|
| PubChem CID | 142967495 |
| Molecular Formula | C27H43N3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | N,2-dimethyl-N'-(5-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl)pentane-1,5-diimine;(3Z)-hexa-1,3,5-triene;N,2,2-trimethylpropan-1-imine |
| SMILES | C/N=C/C(C)(C)C.C/N=C/C(C)CC/C=N/C1=CC=C(C)C2CC12.C=C/C=C\C=C |
| InChI | InChI=1S/C15H22N2.C6H13N.C6H8/c1-11(10-16-3)5-4-8-17-15-7-6-12(2)13-9-14(13)15;1-6(2,3)5-7-4;1-3-5-6-4-2/h6-8,10-11,13-14H,4-5,9H2,1-3H3;5H,1-4H3;3-6H,1-2H2/b16-10+,17-8+;7-5+;6-5- |
| InChIKey | SKKIPHFOMSHTPX-OAFQMWBJSA-N |
| XLogP | 7.30 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|