C17H23N — CID 142002547
(Z)-N-(2,4a-dimethyl-5,8,9,9a-tetrahydrobenzo[7]annulen-6-yl)but-2-en-1-imine (PubChem CID 142002547) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (Z)-N-(2,4a-dimethyl-5,8,9,9a-tetrahydrobenzo[7]annulen-6-yl)but-2-en-1-imine.
| Compound Name | (Z)-N-(2,4a-dimethyl-5,8,9,9a-tetrahydrobenzo[7]annulen-6-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 142002547 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (Z)-N-(2,4a-dimethyl-5,8,9,9a-tetrahydrobenzo[7]annulen-6-yl)but-2-en-1-imine |
| SMILES | C/C=C\C=N\C1=CCCC2C=C(C)C=CC2(C)C1 |
| InChI | InChI=1S/C17H23N/c1-4-5-11-18-16-8-6-7-15-12-14(2)9-10-17(15,3)13-16/h4-5,8-12,15H,6-7,13H2,1-3H3/b5-4-,18-11+ |
| InChIKey | HNQRXRPCAXUJEZ-WZKSGQFBSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|