C31H45N — CID 123304110
4-[(4Z)-5-(2,6-dimethyl-3-propan-2-ylcyclohexen-1-yl)penta-1,2,4-trien-3-yl]-7-methyl-10-propan-2-yl-5,6,7,8,9,10-hexahydro-1-benzazocine (PubChem CID 123304110) has the molecular formula C31H45N and a molecular weight of 431.71 g/mol. Its IUPAC name is 4-[(4Z)-5-(2,6-dimethyl-3-propan-2-ylcyclohexen-1-yl)penta-1,2,4-trien-3-yl]-7-methyl-10-propan-2-yl-5,6,7,8,9,10-hexahydro-1-benzazocine.
| Compound Name | 4-[(4Z)-5-(2,6-dimethyl-3-propan-2-ylcyclohexen-1-yl)penta-1,2,4-trien-3-yl]-7-methyl-10-propan-2-yl-5,6,7,8,9,10-hexahydro-1-benzazocine |
|---|---|
| PubChem CID | 123304110 |
| Molecular Formula | C31H45N |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.36 |
| IUPAC Name | 4-[(4Z)-5-(2,6-dimethyl-3-propan-2-ylcyclohexen-1-yl)penta-1,2,4-trien-3-yl]-7-methyl-10-propan-2-yl-5,6,7,8,9,10-hexahydro-1-benzazocine |
| SMILES | C=C=C(/C=C\C1=C(C)C(C(C)C)CCC1C)C1=C/C=N\C2=C(CC1)C(C)CCC2C(C)C |
| InChI | InChI=1S/C31H45N/c1-9-25(12-16-29-22(6)10-14-27(20(2)3)24(29)8)26-13-17-30-23(7)11-15-28(21(4)5)31(30)32-19-18-26/h12,16,18-23,27-28H,1,10-11,13-15,17H2,2-8H3/b16-12-,26-18?,32-19- |
| InChIKey | IAZKWPPSXSASSS-UXHGUMAFSA-N |
| XLogP | 9.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|