C25H43N — CID 91378339
N-[6-but-1-en-2-yl-3-methylidene-4-(3-methylpentan-3-yl)undec-6-enyl]prop-2-en-1-imine (PubChem CID 91378339) has the molecular formula C25H43N and a molecular weight of 357.63 g/mol. Its IUPAC name is N-[6-but-1-en-2-yl-3-methylidene-4-(3-methylpentan-3-yl)undec-6-enyl]prop-2-en-1-imine.
| Compound Name | N-[6-but-1-en-2-yl-3-methylidene-4-(3-methylpentan-3-yl)undec-6-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 91378339 |
| Molecular Formula | C25H43N |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 357.34 |
| IUPAC Name | N-[6-but-1-en-2-yl-3-methylidene-4-(3-methylpentan-3-yl)undec-6-enyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/CCC(=C)C(CC(=CCCCC)C(=C)CC)C(C)(CC)CC |
| InChI | InChI=1S/C25H43N/c1-9-14-15-16-23(21(6)11-3)20-24(25(8,12-4)13-5)22(7)17-19-26-18-10-2/h10,16,18,24H,2,6-7,9,11-15,17,19-20H2,1,3-5,8H3/b23-16?,26-18+ |
| InChIKey | GPAFGRJOWHFBJX-ZKSPBAGQSA-N |
| XLogP | 8.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|