C23H34FN — CID 10641139
(2E,4E,6Z,8E)-N-butyl-7-fluoro-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 10641139) has the molecular formula C23H34FN and a molecular weight of 343.53 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-N-butyl-7-fluoro-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6Z,8E)-N-butyl-7-fluoro-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 10641139 |
| Molecular Formula | C23H34FN |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (2E,4E,6Z,8E)-N-butyl-7-fluoro-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CCCC/N=C/C=C(C)/C=C/C=C(F)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H34FN/c1-6-7-17-25-18-15-19(2)10-8-12-21(24)13-14-22-20(3)11-9-16-23(22,4)5/h8,10,12-15,18H,6-7,9,11,16-17H2,1-5H3/b10-8+,14-13+,19-15+,21-12-,25-18+ |
| InChIKey | DANUQIRMTQYVJH-SEDGWHOJSA-N |
| XLogP | 7.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|