C22H31F2N — CID 10545623
(2Z,4E,6Z,8E)-N-butyl-3,7-difluoro-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 10545623) has the molecular formula C22H31F2N and a molecular weight of 347.49 g/mol. Its IUPAC name is (2Z,4E,6Z,8E)-N-butyl-3,7-difluoro-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2Z,4E,6Z,8E)-N-butyl-3,7-difluoro-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 10545623 |
| Molecular Formula | C22H31F2N |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | (2Z,4E,6Z,8E)-N-butyl-3,7-difluoro-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CCCC/N=C/C=C(F)/C=C/C=C(F)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H31F2N/c1-5-6-16-25-17-14-20(24)11-7-10-19(23)12-13-21-18(2)9-8-15-22(21,3)4/h7,10-14,17H,5-6,8-9,15-16H2,1-4H3/b11-7+,13-12+,19-10-,20-14-,25-17+ |
| InChIKey | UDCQOEBBOAYAQF-XPQJRZTBSA-N |
| XLogP | 7.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|