C23H35N — CID 123501414
(8E)-10-ethyl-4-methyl-8-pentylidene-6-azatricyclo[9.4.1.02,7]hexadeca-6,11(16),12-triene (PubChem CID 123501414) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (8E)-10-ethyl-4-methyl-8-pentylidene-6-azatricyclo[9.4.1.02,7]hexadeca-6,11(16),12-triene.
| Compound Name | (8E)-10-ethyl-4-methyl-8-pentylidene-6-azatricyclo[9.4.1.02,7]hexadeca-6,11(16),12-triene |
|---|---|
| PubChem CID | 123501414 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (8E)-10-ethyl-4-methyl-8-pentylidene-6-azatricyclo[9.4.1.02,7]hexadeca-6,11(16),12-triene |
| SMILES | CCCC/C=C1\CC(CC)C2=CC(CCC=C2)C2CC(C)CN=C12 |
| InChI | InChI=1S/C23H35N/c1-4-6-7-12-21-14-18(5-2)19-10-8-9-11-20(15-19)22-13-17(3)16-24-23(21)22/h8,10,12,15,17-18,20,22H,4-7,9,11,13-14,16H2,1-3H3/b21-12+ |
| InChIKey | CLMXVWGWPSNGHO-CIAFOILYSA-N |
| XLogP | 6.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|