C19H30N+ — CID 123157647
2,3-diethyl-2,3,5-trimethyl-6-methylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium (PubChem CID 123157647) has the molecular formula C19H30N+ and a molecular weight of 272.46 g/mol. Its IUPAC name is 2,3-diethyl-2,3,5-trimethyl-6-methylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium.
| Compound Name | 2,3-diethyl-2,3,5-trimethyl-6-methylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123157647 |
| Molecular Formula | C19H30N+ |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 2,3-diethyl-2,3,5-trimethyl-6-methylidene-4-prop-1-enyl-1-prop-2-enylidenepyridin-1-ium |
| SMILES | C=C/C=[N+]1\C(=C)C(C)=C(C=CC)C(C)(CC)C1(C)CC |
| InChI | InChI=1S/C19H30N/c1-9-13-17-15(5)16(6)20(14-10-2)19(8,12-4)18(17,7)11-3/h9-10,13-14H,2,6,11-12H2,1,3-5,7-8H3/q+1/b13-9?,20-14+ |
| InChIKey | AKPDHQGVHIBQFH-DXTRBBJQSA-N |
| XLogP | 5.26 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|